C36H32B2N2O4 — CID 139056881
4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium (PubChem CID 139056881) has the molecular formula C36H32B2N2O4 and a molecular weight of 578.29 g/mol. Its IUPAC name is 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium.
| Compound Name | 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 139056881 |
| Molecular Formula | C36H32B2N2O4 |
| Molecular Weight | 578.29 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+]([B-]2(c3ccccc3)Oc3ccccc3O2)cc1.Cc1cc[n+]([B-]2(c3ccccc3)Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/2C18H16BNO2/c2*1-15-11-13-20(14-12-15)19(16-7-3-2-4-8-16)21-17-9-5-6-10-18(17)22-19/h2*2-14H,1H3 |
| InChIKey | SNKKYPXRKRENLN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|