C18H16BNO2 — CID 139056882
4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium (PubChem CID 139056882) has the molecular formula C18H16BNO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium.
| Compound Name | 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 139056882 |
| Molecular Formula | C18H16BNO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-methyl-1-(8-phenyl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)pyridin-1-ium |
| SMILES | Cc1cc[n+]([B-]2(c3ccccc3)Oc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H16BNO2/c1-15-11-13-20(14-12-15)19(16-7-3-2-4-8-16)21-17-9-5-6-10-18(17)22-19/h2-14H,1H3 |
| InChIKey | QKQYMAYSUCLDGF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|