C21H19BF5NO2Si — CID 139159122
trimethyl-[(R)-(2,3,4,5,6-pentafluorophenyl)-(8-pyridin-1-ium-1-yl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)methyl]silane (PubChem CID 139159122) has the molecular formula C21H19BF5NO2Si and a molecular weight of 451.28 g/mol. Its IUPAC name is trimethyl-[(R)-(2,3,4,5,6-pentafluorophenyl)-(8-pyridin-1-ium-1-yl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)methyl]silane.
| Compound Name | trimethyl-[(R)-(2,3,4,5,6-pentafluorophenyl)-(8-pyridin-1-ium-1-yl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)methyl]silane |
|---|---|
| PubChem CID | 139159122 |
| Molecular Formula | C21H19BF5NO2Si |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | trimethyl-[(R)-(2,3,4,5,6-pentafluorophenyl)-(8-pyridin-1-ium-1-yl-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-trien-8-yl)methyl]silane |
| SMILES | C[Si](C)(C)[C@@H](c1c(F)c(F)c(F)c(F)c1F)[B-]1([n+]2ccccc2)Oc2ccccc2O1 |
| InChI | InChI=1S/C21H19BF5NO2Si/c1-31(2,3)21(15-16(23)18(25)20(27)19(26)17(15)24)22(28-11-7-4-8-12-28)29-13-9-5-6-10-14(13)30-22/h4-12,21H,1-3H3/t21-/m0/s1 |
| InChIKey | NXAMJWOAJOBTEL-NRFANRHFSA-N |
| XLogP | 5.13 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|