C24H24BF3N2O2 — CID 102292282
N-methyl-N-[6-[2-(2,4,6-trifluorophenyl)-1,3,2-benzodioxaborol-5-yl]hexyl]pyridin-4-amine (PubChem CID 102292282) has the molecular formula C24H24BF3N2O2 and a molecular weight of 440.27 g/mol. Its IUPAC name is N-methyl-N-[6-[2-(2,4,6-trifluorophenyl)-1,3,2-benzodioxaborol-5-yl]hexyl]pyridin-4-amine.
| Compound Name | N-methyl-N-[6-[2-(2,4,6-trifluorophenyl)-1,3,2-benzodioxaborol-5-yl]hexyl]pyridin-4-amine |
|---|---|
| PubChem CID | 102292282 |
| Molecular Formula | C24H24BF3N2O2 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-methyl-N-[6-[2-(2,4,6-trifluorophenyl)-1,3,2-benzodioxaborol-5-yl]hexyl]pyridin-4-amine |
| SMILES | CN(CCCCCCc1ccc2c(c1)OB(c1c(F)cc(F)cc1F)O2)c1ccncc1 |
| InChI | InChI=1S/C24H24BF3N2O2/c1-30(19-9-11-29-12-10-19)13-5-3-2-4-6-17-7-8-22-23(14-17)32-25(31-22)24-20(27)15-18(26)16-21(24)28/h7-12,14-16H,2-6,13H2,1H3 |
| InChIKey | QCAODEYQBYPBGH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|