C18H16BNO4 — CID 139056314
2-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139056314) has the molecular formula C18H16BNO4 and a molecular weight of 321.14 g/mol. Its IUPAC name is 2-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 2-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139056314 |
| Molecular Formula | C18H16BNO4 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | Cc1cccc[nH+]1.c1ccc2c(c1)O[B-]1(O2)Oc2ccccc2O1 |
| InChI | InChI=1S/C12H8BO4.C6H7N/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;1-6-4-2-3-5-7-6/h1-8H;2-5H,1H3/q-1;/p+1 |
| InChIKey | TWEZVBKKZUAZLS-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 51.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|