C25H29BN2O4 — CID 139180576
2-[(6Z)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)spiro[1,3-dioxa-2-boranuidacyclohex-4-ene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl]-3,4-diethyl-1H-pyrrole (PubChem CID 139180576) has the molecular formula C25H29BN2O4 and a molecular weight of 432.33 g/mol. Its IUPAC name is 2-[(6Z)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)spiro[1,3-dioxa-2-boranuidacyclohex-4-ene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl]-3,4-diethyl-1H-pyrrole.
| Compound Name | 2-[(6Z)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)spiro[1,3-dioxa-2-boranuidacyclohex-4-ene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl]-3,4-diethyl-1H-pyrrole |
|---|---|
| PubChem CID | 139180576 |
| Molecular Formula | C25H29BN2O4 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[(6Z)-6-(3,4-diethylpyrrol-1-ium-2-ylidene)spiro[1,3-dioxa-2-boranuidacyclohex-4-ene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl]-3,4-diethyl-1H-pyrrole |
| SMILES | CCC1=C(CC)/C(=C2\C=C(c3[nH]cc(CC)c3CC)O[B-]3(O2)Oc2ccccc2O3)[NH+]=C1 |
| InChI | InChI=1S/C25H28BN2O4/c1-5-16-14-27-24(18(16)7-3)22-13-23(25-19(8-4)17(6-2)15-28-25)32-26(31-22)29-20-11-9-10-12-21(20)30-26/h9-15,27H,5-8H2,1-4H3/q-1/p+1/b25-23- |
| InChIKey | XJWSAFDNOHDSOQ-BZZOAKBMSA-O |
| XLogP | 3.93 |
| TPSA | 66.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|