C24H22BNO6 — CID 139066811
benzene-1,2-diol;4-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139066811) has the molecular formula C24H22BNO6 and a molecular weight of 431.25 g/mol. Its IUPAC name is benzene-1,2-diol;4-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | benzene-1,2-diol;4-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139066811 |
| Molecular Formula | C24H22BNO6 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | benzene-1,2-diol;4-methylpyridin-1-ium;8,8'-spirobi[7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | Cc1cc[nH+]cc1.Oc1ccccc1O.c1ccc2c(c1)O[B-]1(O2)Oc2ccccc2O1 |
| InChI | InChI=1S/C12H8BO4.C6H7N.C6H6O2/c1-2-6-10-9(5-1)14-13(15-10)16-11-7-3-4-8-12(11)17-13;1-6-2-4-7-5-3-6;7-5-3-1-2-4-6(5)8/h1-8H;2-5H,1H3;1-4,7-8H/q-1;;/p+1 |
| InChIKey | VGOAXRWXODYRFO-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|