C27H23BN2O3 — CID 139173457
N,N-dimethyl-4-(5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl)aniline (PubChem CID 139173457) has the molecular formula C27H23BN2O3 and a molecular weight of 434.30 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl)aniline.
| Compound Name | N,N-dimethyl-4-(5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl)aniline |
|---|---|
| PubChem CID | 139173457 |
| Molecular Formula | C27H23BN2O3 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N,N-dimethyl-4-(5-phenylspiro[3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene-2,8'-7,9-dioxa-8-boranuidabicyclo[4.3.0]nona-1,3,5-triene]-4-yl)aniline |
| SMILES | CN(C)c1ccc(C2=C(c3ccccc3)c3cccc[n+]3[B-]3(O2)Oc2ccccc2O3)cc1 |
| InChI | InChI=1S/C27H23BN2O3/c1-29(2)22-17-15-21(16-18-22)27-26(20-10-4-3-5-11-20)23-12-8-9-19-30(23)28(33-27)31-24-13-6-7-14-25(24)32-28/h3-19H,1-2H3 |
| InChIKey | GONUKTDGOZOBDF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 34.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|