C32H28O2 — CID 139057610
(6R)-6-[(1S)-1-hydroxy-2,2-diphenylethyl]-4,4-diphenylcyclohex-2-en-1-one (PubChem CID 139057610) has the molecular formula C32H28O2 and a molecular weight of 444.57 g/mol. Its IUPAC name is (6R)-6-[(1S)-1-hydroxy-2,2-diphenylethyl]-4,4-diphenylcyclohex-2-en-1-one.
| Compound Name | (6R)-6-[(1S)-1-hydroxy-2,2-diphenylethyl]-4,4-diphenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139057610 |
| Molecular Formula | C32H28O2 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (6R)-6-[(1S)-1-hydroxy-2,2-diphenylethyl]-4,4-diphenylcyclohex-2-en-1-one |
| SMILES | O=C1C=CC(c2ccccc2)(c2ccccc2)C[C@@H]1[C@@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H28O2/c33-29-21-22-32(26-17-9-3-10-18-26,27-19-11-4-12-20-27)23-28(29)31(34)30(24-13-5-1-6-14-24)25-15-7-2-8-16-25/h1-22,28,30-31,34H,23H2/t28-,31+/m0/s1 |
| InChIKey | WYQMLSMSEKKQDQ-QCENPCRXSA-N |
| XLogP | 6.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |