C16H15NO8S — CID 139059299
3-carboxy-4-hydroxybenzenesulfonate;quinolin-1-ium-8-ol;hydrate (PubChem CID 139059299) has the molecular formula C16H15NO8S and a molecular weight of 381.36 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;quinolin-1-ium-8-ol;hydrate.
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;quinolin-1-ium-8-ol;hydrate |
|---|---|
| PubChem CID | 139059299 |
| Molecular Formula | C16H15NO8S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;quinolin-1-ium-8-ol;hydrate |
| SMILES | O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.Oc1cccc2ccc[nH+]c12 |
| InChI | InChI=1S/C9H7NO.C7H6O6S.H2O/c11-8-5-1-3-7-4-2-6-10-9(7)8;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;/h1-6,11H;1-3,8H,(H,9,10)(H,11,12,13);1H2 |
| InChIKey | CGHAUGVPUWPZJL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 180.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|