C36H28B2N8 — CID 139059623
1,5-diphenyl-4,8-bis(3-phenylpyrazol-1-yl)pyrazabole (PubChem CID 139059623) has the molecular formula C36H28B2N8 and a molecular weight of 594.30 g/mol.
| Compound Name | 1,5-diphenyl-4,8-bis(3-phenylpyrazol-1-yl)pyrazabole |
|---|---|
| PubChem CID | 139059623 |
| Molecular Formula | C36H28B2N8 |
| Molecular Weight | 594.30 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | — |
| SMILES | c1ccc(-c2ccn([B@-]3n4c(-c5ccccc5)cc[n+]4[B@@-](n4ccc(-c5ccccc5)n4)n4c(-c5ccccc5)cc[n+]43)n2)cc1 |
| InChI | InChI=1S/C36H28B2N8/c1-5-13-29(14-6-1)33-21-25-41(39-33)37-43-27-23-36(32-19-11-4-12-20-32)46(43)38(42-26-22-34(40-42)30-15-7-2-8-16-30)44-28-24-35(45(37)44)31-17-9-3-10-18-31/h1-28H |
| InChIKey | IXLQXKUFHLCIMI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|