About tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+)
tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) (PubChem CID 139062354) has the molecular formula C36H28BN8Tl
and a molecular weight of 787.87 g/mol. Its IUPAC name is tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+).
Molecular Properties
| Compound Name | tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) |
| PubChem CID | 139062354 |
| Molecular Formula | C36H28BN8Tl |
| Molecular Weight | 787.87 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) |
| SMILES | [Tl+].c1ccc(-c2ccn([B-](n3ccc(-c4ccccc4)n3)(n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C36H28BN8.Tl/c1-5-13-29(14-6-1)33-21-25-42(38-33)37(43-26-22-34(39-43)30-15-7-2-8-16-30,44-27-23-35(40-44)31-17-9-3-10-18-31)45-28-24-36(41-45)32-19-11-4-12-20-32;/h1-28H;/q-1;+1 |
| InChIKey | MZDIQDZSPCEUBS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 787.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+)?
The IUPAC name of tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) (CID 139062354) is tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+).
What is the SMILES notation for tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+)?
The canonical SMILES for tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) is [Tl+].c1ccc(-c2ccn([B-](n3ccc(-c4ccccc4)n3)(n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.
What is the InChIKey of tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+)?
The InChIKey is MZDIQDZSPCEUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H28BN8.Tl/c1-5-13-29(14-6-1)33-21-25-42(38-33)37(43-26-22-34(39-43)30-15-7-2-8-16-30,44-27-23-35(40-44)31-17-9-3-10-18-31)45-28-24-36(41-45)32-19-11-4-12-20-32;/h1-28H;/q-1;+1.
What are the key properties of tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+)?
tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) has a molecular weight of 787.87 g/mol, XLogP of 6.69, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(3-phenylpyrazol-1-yl)boranuide;thallium(1+) is sourced from PubChem (CID 139062354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).