About MesTpCuIICl
MesTpCuIICl (PubChem CID 118855573) has the molecular formula C36H39BClCuN6
and a molecular weight of 665.56 g/mol.
Molecular Properties
| Compound Name | MesTpCuIICl |
| PubChem CID | 118855573 |
| Molecular Formula | C36H39BClCuN6 |
| Molecular Weight | 665.56 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[Cl-].[Cu+2] |
| InChI | InChI=1S/C36H39BN6.ClH.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;;/h10-21H,1-9H3;1H;/q-1;;+2/p-1 |
| InChIKey | GMGNOYYEYWFKOD-UHFFFAOYSA-M |
| XLogP | 4.98 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 665.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze MesTpCuIICl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of MesTpCuIICl?
The IUPAC name of MesTpCuIICl (CID 118855573) is not available.
What is the SMILES notation for MesTpCuIICl?
The canonical SMILES for MesTpCuIICl is Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.[Cl-].[Cu+2].
What is the InChIKey of MesTpCuIICl?
The InChIKey is GMGNOYYEYWFKOD-UHFFFAOYSA-M. The full InChI is InChI=1S/C36H39BN6.ClH.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;;/h10-21H,1-9H3;1H;/q-1;;+2/p-1.
What are the key properties of MesTpCuIICl?
MesTpCuIICl has a molecular weight of 665.56 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for MesTpCuIICl is sourced from PubChem (CID 118855573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).