About CID 118855572
CID 118855572 (PubChem CID 118855572) has the molecular formula C55H54BCuN7OS
and a molecular weight of 935.51 g/mol.
Molecular Properties
| Compound Name | CID 118855572 |
| PubChem CID | 118855572 |
| Molecular Formula | C55H54BCuN7OS |
| Molecular Weight | 935.51 g/mol |
| Exact Mass | 934.35 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.O=NSC(c1ccccc1)(c1ccccc1)c1ccccc1.[Cu+] |
| InChI | InChI=1S/C36H39BN6.C19H15NOS.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;21-20-22-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h10-21H,1-9H3;1-15H;/q-1;;+1 |
| InChIKey | NWBOZJJEKPKKIL-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 935.51 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 118855572 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118855572?
The IUPAC name of CID 118855572 (CID 118855572) is not available.
What is the SMILES notation for CID 118855572?
The canonical SMILES for CID 118855572 is Cc1cc(C)c(-c2ccn([B-](n3ccc(-c4c(C)cc(C)cc4C)n3)n3ccc(-c4c(C)cc(C)cc4C)n3)n2)c(C)c1.O=NSC(c1ccccc1)(c1ccccc1)c1ccccc1.[Cu+].
What is the InChIKey of CID 118855572?
The InChIKey is NWBOZJJEKPKKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H39BN6.C19H15NOS.Cu/c1-22-16-25(4)34(26(5)17-22)31-10-13-41(38-31)37(42-14-11-32(39-42)35-27(6)18-23(2)19-28(35)7)43-15-12-33(40-43)36-29(8)20-24(3)21-30(36)9;21-20-22-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h10-21H,1-9H3;1-15H;/q-1;;+1.
What are the key properties of CID 118855572?
CID 118855572 has a molecular weight of 935.51 g/mol, XLogP of 13.37, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118855572 is sourced from PubChem (CID 118855572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).