C30H20N2O16 — CID 139059747
4-pyridin-1-ium-4-ylpyridin-1-ium;bis(2,4,5-tricarboxybenzoate) (PubChem CID 139059747) has the molecular formula C30H20N2O16 and a molecular weight of 664.49 g/mol. Its IUPAC name is 4-pyridin-1-ium-4-ylpyridin-1-ium;bis(2,4,5-tricarboxybenzoate).
| Compound Name | 4-pyridin-1-ium-4-ylpyridin-1-ium;bis(2,4,5-tricarboxybenzoate) |
|---|---|
| PubChem CID | 139059747 |
| Molecular Formula | C30H20N2O16 |
| Molecular Weight | 664.49 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | 4-pyridin-1-ium-4-ylpyridin-1-ium;bis(2,4,5-tricarboxybenzoate) |
| SMILES | O=C([O-])c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O.O=C([O-])c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O.c1cc(-c2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C10H8N2.2C10H6O8/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-8H;2*1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | VGHOPQLXUXTBIJ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 332.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.49 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |