About ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate
ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate (PubChem CID 139059968) has the molecular formula C18H24Br4O6
and a molecular weight of 656.00 g/mol. Its IUPAC name is ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate |
| PubChem CID | 139059968 |
| Molecular Formula | C18H24Br4O6 |
| Molecular Weight | 656.00 g/mol |
| Exact Mass | 651.83 |
| IUPAC Name | ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C(Br)=C1/O[C@@H](C)C[C@@H]1Br.CCOC(=O)/C(Br)=C1/O[C@@H](C)C[C@@H]1Br |
| InChI | InChI=1S/2C9H12Br2O3/c2*1-3-13-9(12)7(11)8-6(10)4-5(2)14-8/h2*5-6H,3-4H2,1-2H3/b2*8-7-/t2*5-,6-/m00/s1 |
| InChIKey | GNVMAGWNHOXLTM-ITXMCMFRSA-N |
| XLogP | 5.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.00 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate (CID 139059968) is ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate is CCOC(=O)/C(Br)=C1/O[C@@H](C)C[C@@H]1Br.CCOC(=O)/C(Br)=C1/O[C@@H](C)C[C@@H]1Br.
What is the InChIKey of ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate?
The InChIKey is GNVMAGWNHOXLTM-ITXMCMFRSA-N. The full InChI is InChI=1S/2C9H12Br2O3/c2*1-3-13-9(12)7(11)8-6(10)4-5(2)14-8/h2*5-6H,3-4H2,1-2H3/b2*8-7-/t2*5-,6-/m00/s1.
What are the key properties of ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate?
ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate has a molecular weight of 656.00 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-bromo-2-[(3S,5S)-3-bromo-5-methyloxolan-2-ylidene]acetate is sourced from PubChem (CID 139059968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).