C16H20O12S2 — CID 139060518
(1S,5R,6S,7R)-3,3-dioxo-3λ6-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid (PubChem CID 139060518) has the molecular formula C16H20O12S2 and a molecular weight of 468.46 g/mol. Its IUPAC name is (1S,5R,6S,7R)-3,3-dioxo-3λ6-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid.
| Compound Name | (1S,5R,6S,7R)-3,3-dioxo-3λ6-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid |
|---|---|
| PubChem CID | 139060518 |
| Molecular Formula | C16H20O12S2 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | (1S,5R,6S,7R)-3,3-dioxo-3λ6-thiabicyclo[3.2.0]heptane-6,7-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2CS(=O)(=O)C[C@H]2[C@@H]1C(=O)O.O=C(O)[C@@H]1[C@H]2CS(=O)(=O)C[C@H]2[C@@H]1C(=O)O |
| InChI | InChI=1S/2C8H10O6S/c2*9-7(10)5-3-1-15(13,14)2-4(3)6(5)8(11)12/h2*3-6H,1-2H2,(H,9,10)(H,11,12)/t2*3-,4+,5+,6- |
| InChIKey | PEYFIIVMOSVRBD-DEQCOUFVSA-N |
| XLogP | -1.88 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |