C14H16O6S2 — CID 139090803
(1R,4S,5S)-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylic acid (PubChem CID 139090803) has the molecular formula C14H16O6S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,4S,5S)-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylic acid.
| Compound Name | (1R,4S,5S)-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylic acid |
|---|---|
| PubChem CID | 139090803 |
| Molecular Formula | C14H16O6S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (1R,4S,5S)-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylic acid |
| SMILES | O=C1C[C@H]2SC[C@H](C(=O)O)[C@@H]12.O=C1C[C@H]2SC[C@H](C(=O)O)[C@@H]12 |
| InChI | InChI=1S/2C7H8O3S/c2*8-4-1-5-6(4)3(2-11-5)7(9)10/h2*3,5-6H,1-2H2,(H,9,10)/t2*3-,5+,6-/m00/s1 |
| InChIKey | VZTRLWCJLPJCLQ-FYRXAEPMSA-N |
| XLogP | 0.78 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |