C11H18N2 — CID 139061270
2-[2-[(2R)-pyrrolidin-2-yl]propan-2-yl]-1H-pyrrole (PubChem CID 139061270) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-[2-[(2R)-pyrrolidin-2-yl]propan-2-yl]-1H-pyrrole.
| Compound Name | 2-[2-[(2R)-pyrrolidin-2-yl]propan-2-yl]-1H-pyrrole |
|---|---|
| PubChem CID | 139061270 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-[2-[(2R)-pyrrolidin-2-yl]propan-2-yl]-1H-pyrrole |
| SMILES | CC(C)(c1ccc[nH]1)[C@H]1CCCN1 |
| InChI | InChI=1S/C11H18N2/c1-11(2,9-5-3-7-12-9)10-6-4-8-13-10/h3,5,7,10,12-13H,4,6,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | UZERMLSHMABEOT-SNVBAGLBSA-N |
| XLogP | 2.04 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |