C11H16N2O — CID 177219789
1-pyridin-2-yl-1-[(2R)-pyrrolidin-2-yl]ethanol (PubChem CID 177219789) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-pyridin-2-yl-1-[(2R)-pyrrolidin-2-yl]ethanol.
| Compound Name | 1-pyridin-2-yl-1-[(2R)-pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 177219789 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-pyridin-2-yl-1-[(2R)-pyrrolidin-2-yl]ethanol |
| SMILES | CC(O)(c1ccccn1)[C@H]1CCCN1 |
| InChI | InChI=1S/C11H16N2O/c1-11(14,10-6-4-8-13-10)9-5-2-3-7-12-9/h2-3,5,7,10,13-14H,4,6,8H2,1H3/t10-,11?/m1/s1 |
| InChIKey | WGBRVVQXEIVNCT-NFJWQWPMSA-N |
| XLogP | 1.04 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |