C12H8Br3NO4 — CID 139061680
3-bromo-4-methylpyridin-1-ium;2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate (PubChem CID 139061680) has the molecular formula C12H8Br3NO4 and a molecular weight of 469.91 g/mol. Its IUPAC name is 3-bromo-4-methylpyridin-1-ium;2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate.
| Compound Name | 3-bromo-4-methylpyridin-1-ium;2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate |
|---|---|
| PubChem CID | 139061680 |
| Molecular Formula | C12H8Br3NO4 |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 466.80 |
| IUPAC Name | 3-bromo-4-methylpyridin-1-ium;2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate |
| SMILES | Cc1cc[nH+]cc1Br.O=C1C(O)=C(Br)C(=O)C([O-])=C1Br |
| InChI | InChI=1S/C6H2Br2O4.C6H6BrN/c7-1-3(9)5(11)2(8)6(12)4(1)10;1-5-2-3-8-4-6(5)7/h9,12H;2-4H,1H3 |
| InChIKey | VKHLSJBBJIYPHD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|