C18H16Br2N2O4 — CID 139061678
2,5-dibromo-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(3-methylpyridin-1-ium) (PubChem CID 139061678) has the molecular formula C18H16Br2N2O4 and a molecular weight of 484.14 g/mol. Its IUPAC name is 2,5-dibromo-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(3-methylpyridin-1-ium).
| Compound Name | 2,5-dibromo-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(3-methylpyridin-1-ium) |
|---|---|
| PubChem CID | 139061678 |
| Molecular Formula | C18H16Br2N2O4 |
| Molecular Weight | 484.14 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 2,5-dibromo-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(3-methylpyridin-1-ium) |
| SMILES | Cc1ccc[nH+]c1.Cc1ccc[nH+]c1.O=C1C([O-])=C(Br)C(=O)C([O-])=C1Br |
| InChI | InChI=1S/C6H2Br2O4.2C6H7N/c7-1-3(9)5(11)2(8)6(12)4(1)10;2*1-6-3-2-4-7-5-6/h9,12H;2*2-5H,1H3 |
| InChIKey | MUNSLLJGQGABOQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 108.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|