C20H16Cl6N4O4 — CID 139058946
2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(dichloromethane);(E)-1-pyridin-1-ium-4-yl-N-[(E)-pyridin-1-ium-4-ylmethylideneamino]methanimine (PubChem CID 139058946) has the molecular formula C20H16Cl6N4O4 and a molecular weight of 589.09 g/mol. Its IUPAC name is 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(dichloromethane);(E)-1-pyridin-1-ium-4-yl-N-[(E)-pyridin-1-ium-4-ylmethylideneamino]methanimine.
| Compound Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(dichloromethane);(E)-1-pyridin-1-ium-4-yl-N-[(E)-pyridin-1-ium-4-ylmethylideneamino]methanimine |
|---|---|
| PubChem CID | 139058946 |
| Molecular Formula | C20H16Cl6N4O4 |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 585.93 |
| IUPAC Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(dichloromethane);(E)-1-pyridin-1-ium-4-yl-N-[(E)-pyridin-1-ium-4-ylmethylideneamino]methanimine |
| SMILES | C(=N/N=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.ClCCl.ClCCl.O=C1C([O-])=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C12H10N4.C6H2Cl2O4.2CH2Cl2/c1-5-13-6-2-11(1)9-15-16-10-12-3-7-14-8-4-12;7-1-3(9)5(11)2(8)6(12)4(1)10;2*2-1-3/h1-10H;9,12H;2*1H2/b15-9+,16-10+;;; |
| InChIKey | WNBWRYIYGCYUQN-DYMOOXBESA-N |
| XLogP | 2.37 |
| TPSA | 133.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|