C11H9Cl2NO5 — CID 139056679
2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium;hydrate (PubChem CID 139056679) has the molecular formula C11H9Cl2NO5 and a molecular weight of 306.10 g/mol. Its IUPAC name is 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium;hydrate.
| Compound Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium;hydrate |
|---|---|
| PubChem CID | 139056679 |
| Molecular Formula | C11H9Cl2NO5 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2,5-dichloro-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;pyridin-1-ium;hydrate |
| SMILES | O.O=C1C(O)=C(Cl)C(=O)C([O-])=C1Cl.c1cc[nH+]cc1 |
| InChI | InChI=1S/C6H2Cl2O4.C5H5N.H2O/c7-1-3(9)5(11)2(8)6(12)4(1)10;1-2-4-6-5-3-1;/h9,12H;1-5H;1H2 |
| InChIKey | FIDBPFOXNGEJGP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|