C18H24Cl2N2O8 — CID 139197384
2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(4-methylpyridin-1-ium);tetrahydrate (PubChem CID 139197384) has the molecular formula C18H24Cl2N2O8 and a molecular weight of 467.30 g/mol. Its IUPAC name is 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(4-methylpyridin-1-ium);tetrahydrate.
| Compound Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(4-methylpyridin-1-ium);tetrahydrate |
|---|---|
| PubChem CID | 139197384 |
| Molecular Formula | C18H24Cl2N2O8 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(4-methylpyridin-1-ium);tetrahydrate |
| SMILES | Cc1cc[nH+]cc1.Cc1cc[nH+]cc1.O.O.O.O.O=C1C([O-])=C(Cl)C(=O)C([O-])=C1Cl |
| InChI | InChI=1S/C6H2Cl2O4.2C6H7N.4H2O/c7-1-3(9)5(11)2(8)6(12)4(1)10;2*1-6-2-4-7-5-3-6;;;;/h9,12H;2*2-5H,1H3;4*1H2 |
| InChIKey | FHXMJGHFICKDGN-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 234.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|