N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid

C9H13N3O5 — CID 139062269

IUPACN,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid
SMILESCC(=O)N(C)C.O=C(O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C5H4N2O4.C4H9NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(6)5(2)3/h1H,(H,9,10)(H2,6,7,8,11);1-3H3
InChIKeyUEXSQBNNMNXDEU-UHFFFAOYSA-N
MW243.22 g/mol
LogP-1.14
Rot. Bonds1

About N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid

N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 139062269) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid.

Molecular Properties

Compound NameN,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid
PubChem CID139062269
Molecular FormulaC9H13N3O5
Molecular Weight243.22 g/mol
Exact Mass243.09
IUPAC NameN,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid
SMILESCC(=O)N(C)C.O=C(O)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C5H4N2O4.C4H9NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(6)5(2)3/h1H,(H,9,10)(H2,6,7,8,11);1-3H3
InChIKeyUEXSQBNNMNXDEU-UHFFFAOYSA-N
XLogP-1.14
TPSA123.33 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 5-1.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid (CID 139062269) is N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid is CC(=O)N(C)C.O=C(O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The InChIKey is UEXSQBNNMNXDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4.C4H9NO/c8-3-2(4(9)10)1-6-5(11)7-3;1-4(6)5(2)3/h1H,(H,9,10)(H2,6,7,8,11);1-3H3.
What are the key properties of N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid has a molecular weight of 243.22 g/mol, XLogP of -1.14, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;2,4-dioxo-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 139062269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).