C7H5FN2O5 — CID 59646354
3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-oxopropanoic acid (PubChem CID 59646354) has the molecular formula C7H5FN2O5 and a molecular weight of 216.12 g/mol. Its IUPAC name is 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-oxopropanoic acid.
| Compound Name | 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 59646354 |
| Molecular Formula | C7H5FN2O5 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H5FN2O5/c8-3-2-10(4(11)1-5(12)13)7(15)9-6(3)14/h2H,1H2,(H,12,13)(H,9,14,15) |
| InChIKey | RBUNZLFXLZNTFQ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|