C21H22N2O2 — CID 139064595
2-(2,3-dimethylanilino)benzoic acid;2-methylpyridine (PubChem CID 139064595) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)benzoic acid;2-methylpyridine.
| Compound Name | 2-(2,3-dimethylanilino)benzoic acid;2-methylpyridine |
|---|---|
| PubChem CID | 139064595 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-(2,3-dimethylanilino)benzoic acid;2-methylpyridine |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)O)c1C.Cc1ccccn1 |
| InChI | InChI=1S/C15H15NO2.C6H7N/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;1-6-4-2-3-5-7-6/h3-9,16H,1-2H3,(H,17,18);2-5H,1H3 |
| InChIKey | IPKJVBCLBVRQOG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |