C19H22BF3N2O3S — CID 139064871
spiro[7,9-diazonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-8,9'-9-boranuidabicyclo[3.3.1]nonane];trifluoromethanesulfonate (PubChem CID 139064871) has the molecular formula C19H22BF3N2O3S and a molecular weight of 426.27 g/mol. Its IUPAC name is spiro[7,9-diazonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-8,9'-9-boranuidabicyclo[3.3.1]nonane];trifluoromethanesulfonate.
| Compound Name | spiro[7,9-diazonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-8,9'-9-boranuidabicyclo[3.3.1]nonane];trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139064871 |
| Molecular Formula | C19H22BF3N2O3S |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | spiro[7,9-diazonia-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene-8,9'-9-boranuidabicyclo[3.3.1]nonane];trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1cc[n+]2c(c1)-c1cccc[n+]1[B-]21C2CCCC1CCC2 |
| InChI | InChI=1S/C18H22BN2.CHF3O3S/c1-3-13-20-17(11-1)18-12-2-4-14-21(18)19(20)15-7-5-8-16(19)10-6-9-15;2-1(3,4)8(5,6)7/h1-4,11-16H,5-10H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ZDFXSVCFGLPTNJ-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|