C18H18CuF6N4O6S2 — CID 139075450
copper;1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine;bis(trifluoromethanesulfonate) (PubChem CID 139075450) has the molecular formula C18H18CuF6N4O6S2 and a molecular weight of 628.03 g/mol. Its IUPAC name is copper;1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine;bis(trifluoromethanesulfonate).
| Compound Name | copper;1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139075450 |
| Molecular Formula | C18H18CuF6N4O6S2 |
| Molecular Weight | 628.03 g/mol |
| Exact Mass | 626.99 |
| IUPAC Name | copper;1-pyridin-2-yl-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]ethanimine;bis(trifluoromethanesulfonate) |
| SMILES | C/C(=N\CC/N=C(\C)c1ccccn1)c1ccccn1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/C16H18N4.2CHF3O3S.Cu/c1-13(15-7-3-5-9-19-15)17-11-12-18-14(2)16-8-4-6-10-20-16;2*2-1(3,4)8(5,6)7;/h3-10H,11-12H2,1-2H3;2*(H,5,6,7);/q;;;+2/p-2/b17-13+,18-14+;;; |
| InChIKey | BWDJDMUXTRVNQH-SQOWISFMSA-L |
| XLogP | 2.90 |
| TPSA | 164.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.03 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|