C18H22F6FeN4O6S2 — CID 53314874
N,N'-dimethyl-N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine;iron(2+);bis(trifluoromethanesulfonate) (PubChem CID 53314874) has the molecular formula C18H22F6FeN4O6S2 and a molecular weight of 624.36 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine;iron(2+);bis(trifluoromethanesulfonate).
| Compound Name | N,N'-dimethyl-N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine;iron(2+);bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 53314874 |
| Molecular Formula | C18H22F6FeN4O6S2 |
| Molecular Weight | 624.36 g/mol |
| Exact Mass | 624.02 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(pyridin-2-ylmethyl)ethane-1,2-diamine;iron(2+);bis(trifluoromethanesulfonate) |
| SMILES | CN(CCN(C)Cc1ccccn1)Cc1ccccn1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Fe+2] |
| InChI | InChI=1S/C16H22N4.2CHF3O3S.Fe/c1-19(13-15-7-3-5-9-17-15)11-12-20(2)14-16-8-4-6-10-18-16;2*2-1(3,4)8(5,6)7;/h3-10H,11-14H2,1-2H3;2*(H,5,6,7);/q;;;+2/p-2 |
| InChIKey | HNWGYORXODUZFL-UHFFFAOYSA-L |
| XLogP | 2.14 |
| TPSA | 146.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|