C16H24CoF6N4O6S2 — CID 53314871
cobalt(2+);1,4-dimethyl-7-(pyridin-2-ylmethyl)-1,4,7-triazonane;bis(trifluoromethanesulfonate) (PubChem CID 53314871) has the molecular formula C16H24CoF6N4O6S2 and a molecular weight of 605.45 g/mol. Its IUPAC name is cobalt(2+);1,4-dimethyl-7-(pyridin-2-ylmethyl)-1,4,7-triazonane;bis(trifluoromethanesulfonate).
| Compound Name | cobalt(2+);1,4-dimethyl-7-(pyridin-2-ylmethyl)-1,4,7-triazonane;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 53314871 |
| Molecular Formula | C16H24CoF6N4O6S2 |
| Molecular Weight | 605.45 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | cobalt(2+);1,4-dimethyl-7-(pyridin-2-ylmethyl)-1,4,7-triazonane;bis(trifluoromethanesulfonate) |
| SMILES | CN1CCN(C)CCN(Cc2ccccn2)CC1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Co+2] |
| InChI | InChI=1S/C14H24N4.2CHF3O3S.Co/c1-16-7-8-17(2)10-12-18(11-9-16)13-14-5-3-4-6-15-14;2*2-1(3,4)8(5,6)7;/h3-6H,7-13H2,1-2H3;2*(H,5,6,7);/q;;;+2/p-2 |
| InChIKey | RQGRJFOASUVFCK-UHFFFAOYSA-L |
| XLogP | 0.86 |
| TPSA | 137.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|