C21H20Cl2O2 — CID 139065413
(2S,3R,5S,6R)-2,6-bis(2-chlorophenyl)-3,5-dimethyl-4-oxocyclohexane-1-carbaldehyde (PubChem CID 139065413) has the molecular formula C21H20Cl2O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2,6-bis(2-chlorophenyl)-3,5-dimethyl-4-oxocyclohexane-1-carbaldehyde.
| Compound Name | (2S,3R,5S,6R)-2,6-bis(2-chlorophenyl)-3,5-dimethyl-4-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 139065413 |
| Molecular Formula | C21H20Cl2O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (2S,3R,5S,6R)-2,6-bis(2-chlorophenyl)-3,5-dimethyl-4-oxocyclohexane-1-carbaldehyde |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@H](c2ccccc2Cl)C(C=O)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C21H20Cl2O2/c1-12-19(14-7-3-5-9-17(14)22)16(11-24)20(13(2)21(12)25)15-8-4-6-10-18(15)23/h3-13,16,19-20H,1-2H3/t12-,13+,16?,19+,20- |
| InChIKey | KHZOQNCWRJZKNT-PXOXZKLGSA-N |
| XLogP | 5.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|