C22H33NO — CID 139065420
(4aS,4bR,10aR,10bS,12aS)-10a,12a-dimethyl-1-prop-2-enyl-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydronaphtho[2,1-f]quinolin-8-one (PubChem CID 139065420) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (4aS,4bR,10aR,10bS,12aS)-10a,12a-dimethyl-1-prop-2-enyl-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydronaphtho[2,1-f]quinolin-8-one.
| Compound Name | (4aS,4bR,10aR,10bS,12aS)-10a,12a-dimethyl-1-prop-2-enyl-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydronaphtho[2,1-f]quinolin-8-one |
|---|---|
| PubChem CID | 139065420 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (4aS,4bR,10aR,10bS,12aS)-10a,12a-dimethyl-1-prop-2-enyl-2,3,4,4a,4b,5,6,9,10,10b,11,12-dodecahydronaphtho[2,1-f]quinolin-8-one |
| SMILES | C=CCN1CCC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H33NO/c1-4-13-23-14-5-6-20-18-8-7-16-15-17(24)9-11-21(16,2)19(18)10-12-22(20,23)3/h4,15,18-20H,1,5-14H2,2-3H3/t18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | RFLYTLGIUFXZKU-FXTUREPZSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|