C19H18Cl2O2 — CID 139065709
(2S,3R,5S,6R)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-one (PubChem CID 139065709) has the molecular formula C19H18Cl2O2 and a molecular weight of 349.26 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-one.
| Compound Name | (2S,3R,5S,6R)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-one |
|---|---|
| PubChem CID | 139065709 |
| Molecular Formula | C19H18Cl2O2 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2S,3R,5S,6R)-2,6-bis(4-chlorophenyl)-3,5-dimethyloxan-4-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@@H](c2ccc(Cl)cc2)O[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2O2/c1-11-17(22)12(2)19(14-5-9-16(21)10-6-14)23-18(11)13-3-7-15(20)8-4-13/h3-12,18-19H,1-2H3/t11-,12+,18-,19+ |
| InChIKey | WXCCAIAFARANBU-ALICBKBLSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |