C18H29IO3 — CID 139066613
ethyl (1R,11R,12S)-12-iodo-15-oxobicyclo[9.3.1]pentadecane-1-carboxylate (PubChem CID 139066613) has the molecular formula C18H29IO3 and a molecular weight of 420.33 g/mol. Its IUPAC name is ethyl (1R,11R,12S)-12-iodo-15-oxobicyclo[9.3.1]pentadecane-1-carboxylate.
| Compound Name | ethyl (1R,11R,12S)-12-iodo-15-oxobicyclo[9.3.1]pentadecane-1-carboxylate |
|---|---|
| PubChem CID | 139066613 |
| Molecular Formula | C18H29IO3 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | ethyl (1R,11R,12S)-12-iodo-15-oxobicyclo[9.3.1]pentadecane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCCCCCCC[C@H](C1=O)[C@@H](I)CC2 |
| InChI | InChI=1S/C18H29IO3/c1-2-22-17(21)18-12-9-7-5-3-4-6-8-10-14(16(18)20)15(19)11-13-18/h14-15H,2-13H2,1H3/t14-,15-,18+/m0/s1 |
| InChIKey | ABOGWFZQGQBNSC-RLFYNMQTSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|