C23H25N3O4 — CID 139066913
6-hexyl-7-hydroxy-3-(3-phenyl-1H-1,2,4-triazol-5-yl)chromen-2-one;hydrate (PubChem CID 139066913) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 6-hexyl-7-hydroxy-3-(3-phenyl-1H-1,2,4-triazol-5-yl)chromen-2-one;hydrate.
| Compound Name | 6-hexyl-7-hydroxy-3-(3-phenyl-1H-1,2,4-triazol-5-yl)chromen-2-one;hydrate |
|---|---|
| PubChem CID | 139066913 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 6-hexyl-7-hydroxy-3-(3-phenyl-1H-1,2,4-triazol-5-yl)chromen-2-one;hydrate |
| SMILES | CCCCCCc1cc2cc(-c3nc(-c4ccccc4)n[nH]3)c(=O)oc2cc1O.O |
| InChI | InChI=1S/C23H23N3O3.H2O/c1-2-3-4-6-11-16-12-17-13-18(23(28)29-20(17)14-19(16)27)22-24-21(25-26-22)15-9-7-5-8-10-15;/h5,7-10,12-14,27H,2-4,6,11H2,1H3,(H,24,25,26);1H2 |
| InChIKey | PZYZKBVZYFGRFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|