C19H15FN4O3S — CID 18224892
4-[[4-amino-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 18224892) has the molecular formula C19H15FN4O3S and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[4-amino-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[[4-amino-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 18224892 |
| Molecular Formula | C19H15FN4O3S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-[[4-amino-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(CSc3nnc(-c4ccccc4F)n3N)cc(=O)oc12 |
| InChI | InChI=1S/C19H15FN4O3S/c1-10-15(25)7-6-12-11(8-16(26)27-17(10)12)9-28-19-23-22-18(24(19)21)13-4-2-3-5-14(13)20/h2-8,25H,9,21H2,1H3 |
| InChIKey | JCBCQXIZCCUZDO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|