C84H108N8 — CID 139067728
N,N-dibutyl-4-[(E)-2-[2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]aniline (PubChem CID 139067728) has the molecular formula C84H108N8 and a molecular weight of 1229.84 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-2-[2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]aniline.
| Compound Name | N,N-dibutyl-4-[(E)-2-[2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]aniline |
|---|---|
| PubChem CID | 139067728 |
| Molecular Formula | C84H108N8 |
| Molecular Weight | 1229.84 g/mol |
| Exact Mass | 1228.87 |
| IUPAC Name | N,N-dibutyl-4-[(E)-2-[2-[4-[(E)-2-[4-(dibutylamino)phenyl]ethenyl]-2-pyridinyl]-4-pyridinyl]ethenyl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccnc(-c3cc(/C=C/c4ccc(N(CCCC)CCCC)cc4)ccn3)c2)cc1.CCCCN(CCCC)c1ccc(/C=C/c2ccnc(-c3cc(/C=C/c4ccc(N(CCCC)CCCC)cc4)ccn3)c2)cc1 |
| InChI | InChI=1S/2C42H54N4/c2*1-5-9-29-45(30-10-6-2)39-21-17-35(18-22-39)13-15-37-25-27-43-41(33-37)42-34-38(26-28-44-42)16-14-36-19-23-40(24-20-36)46(31-11-7-3)32-12-8-4/h2*13-28,33-34H,5-12,29-32H2,1-4H3/b2*15-13+,16-14+ |
| InChIKey | FQHAFHDRRMNQQB-HHOUVETASA-N |
| XLogP | 22.60 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.84 |
| LogP ≤ 5 | 22.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|