C24H16N2O2Pd — CID 139068437
benzene-1,2-diolate;palladium(2+);2-quinolin-2-ylquinoline (PubChem CID 139068437) has the molecular formula C24H16N2O2Pd and a molecular weight of 470.82 g/mol. Its IUPAC name is benzene-1,2-diolate;palladium(2+);2-quinolin-2-ylquinoline.
| Compound Name | benzene-1,2-diolate;palladium(2+);2-quinolin-2-ylquinoline |
|---|---|
| PubChem CID | 139068437 |
| Molecular Formula | C24H16N2O2Pd |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | benzene-1,2-diolate;palladium(2+);2-quinolin-2-ylquinoline |
| SMILES | [O-]c1ccccc1[O-].[Pd+2].c1ccc2nc(-c3ccc4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C18H12N2.C6H6O2.Pd/c1-3-7-15-13(5-1)9-11-17(19-15)18-12-10-14-6-2-4-8-16(14)20-18;7-5-3-1-2-4-6(5)8;/h1-12H;1-4,7-8H;/q;;+2/p-2 |
| InChIKey | UMBUPSNECWMVPO-UHFFFAOYSA-L |
| XLogP | 4.28 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |