About zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate
zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate (PubChem CID 139070326) has the molecular formula C37H33BN6O2Zn
and a molecular weight of 669.91 g/mol. Its IUPAC name is zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate.
Molecular Properties
| Compound Name | zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate |
| PubChem CID | 139070326 |
| Molecular Formula | C37H33BN6O2Zn |
| Molecular Weight | 669.91 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate |
| SMILES | Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.O=C([O-])c1ccccc1.[Zn+2] |
| InChI | InChI=1S/C30H28BN6.C7H6O2.Zn/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;8-7(9)6-4-2-1-3-5-6;/h4-21,31H,1-3H3;1-5H,(H,8,9);/q-1;;+2/p-1 |
| InChIKey | ZOWWUXUXURCGBM-UHFFFAOYSA-M |
| XLogP | 5.91 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 669.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate?
The IUPAC name of zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate (CID 139070326) is zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate.
What is the SMILES notation for zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate?
The canonical SMILES for zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate is Cc1cc(-c2ccccc2)nn1[BH-](n1nc(-c2ccccc2)cc1C)n1nc(-c2ccccc2)cc1C.O=C([O-])c1ccccc1.[Zn+2].
What is the InChIKey of zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate?
The InChIKey is ZOWWUXUXURCGBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H28BN6.C7H6O2.Zn/c1-22-19-28(25-13-7-4-8-14-25)32-35(22)31(36-23(2)20-29(33-36)26-15-9-5-10-16-26)37-24(3)21-30(34-37)27-17-11-6-12-18-27;8-7(9)6-4-2-1-3-5-6;/h4-21,31H,1-3H3;1-5H,(H,8,9);/q-1;;+2/p-1.
What are the key properties of zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate?
zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate has a molecular weight of 669.91 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;tris(5-methyl-3-phenylpyrazol-1-yl)boranuide;benzoate is sourced from PubChem (CID 139070326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).