C18H16F6N2O6S2 — CID 139070424
5,14-dimethyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;bis(trifluoromethanesulfonate) (PubChem CID 139070424) has the molecular formula C18H16F6N2O6S2 and a molecular weight of 534.46 g/mol. Its IUPAC name is 5,14-dimethyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;bis(trifluoromethanesulfonate).
| Compound Name | 5,14-dimethyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139070424 |
| Molecular Formula | C18H16F6N2O6S2 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 5,14-dimethyl-1,4-diazoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaene;bis(trifluoromethanesulfonate) |
| SMILES | Cc1ccc2ccc3ccc(C)[n+]4c3c2[n+]1CC4.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H16N2.2CHF3O3S/c1-11-3-5-13-7-8-14-6-4-12(2)18-10-9-17(11)15(13)16(14)18;2*2-1(3,4)8(5,6)7/h3-8H,9-10H2,1-2H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | LBFWQWUGVCKUGC-UHFFFAOYSA-L |
| XLogP | 2.30 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|