About zinc;2-pyridin-2-ylpyridine;dibenzoate
zinc;2-pyridin-2-ylpyridine;dibenzoate (PubChem CID 139070674) has the molecular formula C24H18N2O4Zn
and a molecular weight of 463.81 g/mol. Its IUPAC name is zinc;2-pyridin-2-ylpyridine;dibenzoate.
Molecular Properties
| Compound Name | zinc;2-pyridin-2-ylpyridine;dibenzoate |
| PubChem CID | 139070674 |
| Molecular Formula | C24H18N2O4Zn |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | zinc;2-pyridin-2-ylpyridine;dibenzoate |
| SMILES | O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Zn+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C7H6O2.Zn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*8-7(9)6-4-2-1-3-5-6;/h1-8H;2*1-5H,(H,8,9);/q;;;+2/p-2 |
| InChIKey | LKYYYNTVFDLCIC-UHFFFAOYSA-L |
| XLogP | 2.24 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-pyridin-2-ylpyridine;dibenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-pyridin-2-ylpyridine;dibenzoate?
The IUPAC name of zinc;2-pyridin-2-ylpyridine;dibenzoate (CID 139070674) is zinc;2-pyridin-2-ylpyridine;dibenzoate.
What is the SMILES notation for zinc;2-pyridin-2-ylpyridine;dibenzoate?
The canonical SMILES for zinc;2-pyridin-2-ylpyridine;dibenzoate is O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Zn+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of zinc;2-pyridin-2-ylpyridine;dibenzoate?
The InChIKey is LKYYYNTVFDLCIC-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8N2.2C7H6O2.Zn/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*8-7(9)6-4-2-1-3-5-6;/h1-8H;2*1-5H,(H,8,9);/q;;;+2/p-2.
What are the key properties of zinc;2-pyridin-2-ylpyridine;dibenzoate?
zinc;2-pyridin-2-ylpyridine;dibenzoate has a molecular weight of 463.81 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-pyridin-2-ylpyridine;dibenzoate is sourced from PubChem (CID 139070674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).