C26H18N8O6 — CID 139070798
1-N',2-N'-dihydroxyethanediimidamide;bis(1,10-phenanthroline-5,6-dione) (PubChem CID 139070798) has the molecular formula C26H18N8O6 and a molecular weight of 538.48 g/mol. Its IUPAC name is 1-N',2-N'-dihydroxyethanediimidamide;bis(1,10-phenanthroline-5,6-dione).
| Compound Name | 1-N',2-N'-dihydroxyethanediimidamide;bis(1,10-phenanthroline-5,6-dione) |
|---|---|
| PubChem CID | 139070798 |
| Molecular Formula | C26H18N8O6 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 1-N',2-N'-dihydroxyethanediimidamide;bis(1,10-phenanthroline-5,6-dione) |
| SMILES | NC(=N\O)/C(N)=N/O.O=C1C(=O)c2cccnc2-c2ncccc21.O=C1C(=O)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/2C12H6N2O2.C2H6N4O2/c2*15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;3-1(5-7)2(4)6-8/h2*1-6H;7-8H,(H2,3,5)(H2,4,6) |
| InChIKey | KIABOERMLZIAEH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 237.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|