C18H20N2S3 — CID 139072104
2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)-1,3-diazinane (PubChem CID 139072104) has the molecular formula C18H20N2S3 and a molecular weight of 360.57 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)-1,3-diazinane.
| Compound Name | 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)-1,3-diazinane |
|---|---|
| PubChem CID | 139072104 |
| Molecular Formula | C18H20N2S3 |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-thiophen-2-yl-1,3-bis(thiophen-2-ylmethyl)-1,3-diazinane |
| SMILES | c1csc(CN2CCCN(Cc3cccs3)C2c2cccs2)c1 |
| InChI | InChI=1S/C18H20N2S3/c1-5-15(21-10-1)13-19-8-4-9-20(14-16-6-2-11-22-16)18(19)17-7-3-12-23-17/h1-3,5-7,10-12,18H,4,8-9,13-14H2 |
| InChIKey | YLPWOGQDCDYCCL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |