About bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate
bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate (PubChem CID 139072150) has the molecular formula C22H46O3
and a molecular weight of 358.61 g/mol. Its IUPAC name is bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate.
Molecular Properties
| Compound Name | bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate |
| PubChem CID | 139072150 |
| Molecular Formula | C22H46O3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.34 |
| IUPAC Name | bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate |
| SMILES | CC(C)(C)[C@H]1CC[C@@](C)(O)CC1.CC(C)(C)[C@H]1CC[C@](C)(O)CC1.O |
| InChI | InChI=1S/2C11H22O.H2O/c2*1-10(2,3)9-5-7-11(4,12)8-6-9;/h2*9,12H,5-8H2,1-4H3;1H2/t9-,11+;9-,11-; |
| InChIKey | QXUBNJWTIYPZFA-BNUZBJDLSA-N |
| XLogP | 5.12 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate?
The IUPAC name of bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate (CID 139072150) is bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate.
What is the SMILES notation for bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate?
The canonical SMILES for bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate is CC(C)(C)[C@H]1CC[C@@](C)(O)CC1.CC(C)(C)[C@H]1CC[C@](C)(O)CC1.O.
What is the InChIKey of bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate?
The InChIKey is QXUBNJWTIYPZFA-BNUZBJDLSA-N. The full InChI is InChI=1S/2C11H22O.H2O/c2*1-10(2,3)9-5-7-11(4,12)8-6-9;/h2*9,12H,5-8H2,1-4H3;1H2/t9-,11+;9-,11-;.
What are the key properties of bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate?
bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate has a molecular weight of 358.61 g/mol, XLogP of 5.12, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butyl-1-methylcyclohexan-1-ol);hydrate is sourced from PubChem (CID 139072150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).