C28H27FN4O3 — CID 139073164
N,N-dimethylformamide;(8S)-8-(4-fluorophenyl)-11,11-dimethyl-5,9-dioxo-6,8,10,12-tetrahydroquinolino[1,2-a]quinazoline-7-carbonitrile (PubChem CID 139073164) has the molecular formula C28H27FN4O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is N,N-dimethylformamide;(8S)-8-(4-fluorophenyl)-11,11-dimethyl-5,9-dioxo-6,8,10,12-tetrahydroquinolino[1,2-a]quinazoline-7-carbonitrile.
| Compound Name | N,N-dimethylformamide;(8S)-8-(4-fluorophenyl)-11,11-dimethyl-5,9-dioxo-6,8,10,12-tetrahydroquinolino[1,2-a]quinazoline-7-carbonitrile |
|---|---|
| PubChem CID | 139073164 |
| Molecular Formula | C28H27FN4O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | N,N-dimethylformamide;(8S)-8-(4-fluorophenyl)-11,11-dimethyl-5,9-dioxo-6,8,10,12-tetrahydroquinolino[1,2-a]quinazoline-7-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N1C(=C(C#N)[C@@H]2c2ccc(F)cc2)NC(=O)c2ccccc21.CN(C)C=O |
| InChI | InChI=1S/C25H20FN3O2.C3H7NO/c1-25(2)11-19-22(20(30)12-25)21(14-7-9-15(26)10-8-14)17(13-27)23-28-24(31)16-5-3-4-6-18(16)29(19)23;1-4(2)3-5/h3-10,21H,11-12H2,1-2H3,(H,28,31);3H,1-2H3/t21-;/m0./s1 |
| InChIKey | ZYHQLOAKKZSFOW-BOXHHOBZSA-N |
| XLogP | 4.26 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|