C34H24N6NiO4 — CID 139073342
bis((NE,2Z)-3-hydroxy-N-(pyridin-2-ylmethylidene)naphthalene-2-carbohydrazonate);nickel(2+) (PubChem CID 139073342) has the molecular formula C34H24N6NiO4 and a molecular weight of 639.30 g/mol. Its IUPAC name is bis((NE,2Z)-3-hydroxy-N-(pyridin-2-ylmethylidene)naphthalene-2-carbohydrazonate);nickel(2+).
| Compound Name | bis((NE,2Z)-3-hydroxy-N-(pyridin-2-ylmethylidene)naphthalene-2-carbohydrazonate);nickel(2+) |
|---|---|
| PubChem CID | 139073342 |
| Molecular Formula | C34H24N6NiO4 |
| Molecular Weight | 639.30 g/mol |
| Exact Mass | 638.12 |
| IUPAC Name | bis((NE,2Z)-3-hydroxy-N-(pyridin-2-ylmethylidene)naphthalene-2-carbohydrazonate);nickel(2+) |
| SMILES | [Ni+2].[O-]/C(=N\N=C/c1ccccn1)c1cc2ccccc2cc1O.[O-]/C(=N\N=C\c1ccccn1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/2C17H13N3O2.Ni/c2*21-16-10-13-6-2-1-5-12(13)9-15(16)17(22)20-19-11-14-7-3-4-8-18-14;/h2*1-11,21H,(H,20,22);/q;;+2/p-2/b19-11+;19-11-; |
| InChIKey | NGBBMCKIKGGLEB-ACPOXNRLSA-L |
| XLogP | 4.16 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|