C24H42N2O8 — CID 139074129
tert-butyl N-[(3S)-3-(2-methylpropyl)-2-oxooxetan-3-yl]carbamate (PubChem CID 139074129) has the molecular formula C24H42N2O8 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-(2-methylpropyl)-2-oxooxetan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-(2-methylpropyl)-2-oxooxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 139074129 |
| Molecular Formula | C24H42N2O8 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | tert-butyl N-[(3S)-3-(2-methylpropyl)-2-oxooxetan-3-yl]carbamate |
| SMILES | CC(C)C[C@]1(NC(=O)OC(C)(C)C)COC1=O.CC(C)C[C@]1(NC(=O)OC(C)(C)C)COC1=O |
| InChI | InChI=1S/2C12H21NO4/c2*1-8(2)6-12(7-16-9(12)14)13-10(15)17-11(3,4)5/h2*8H,6-7H2,1-5H3,(H,13,15)/t2*12-/m00/s1 |
| InChIKey | VFGLGLOCANKRFJ-ILSZIBLNSA-N |
| XLogP | 3.71 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|