C19H14N4O2 — CID 139074819
2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenol;hydrate (PubChem CID 139074819) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenol;hydrate.
| Compound Name | 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenol;hydrate |
|---|---|
| PubChem CID | 139074819 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)phenol;hydrate |
| SMILES | O.Oc1ccccc1-c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C19H12N4O.H2O/c24-14-8-2-1-5-11(14)19-22-17-12-6-3-9-20-15(12)16-13(18(17)23-19)7-4-10-21-16;/h1-10,24H,(H,22,23);1H2 |
| InChIKey | YDYOHKAAULFCRL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|